C17H14ClN5S3 — CID 18708188
4-[3-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]-N,N-dimethylaniline (PubChem CID 18708188) has the molecular formula C17H14ClN5S3 and a molecular weight of 419.99 g/mol. Its IUPAC name is 4-[3-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]-N,N-dimethylaniline.
| Compound Name | 4-[3-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 18708188 |
| Molecular Formula | C17H14ClN5S3 |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 4-[3-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-n2c(Sc3ncc(Cl)s3)nnc2-c2cccs2)cc1 |
| InChI | InChI=1S/C17H14ClN5S3/c1-22(2)11-5-7-12(8-6-11)23-15(13-4-3-9-24-13)20-21-16(23)26-17-19-10-14(18)25-17/h3-10H,1-2H3 |
| InChIKey | HSQGISJTAAJHIF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|