C34H27ClN8S6 — CID 67673353
5-chloro-2-[[4-(2-phenylethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole;2-[[4-(2-phenylethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole (PubChem CID 67673353) has the molecular formula C34H27ClN8S6 and a molecular weight of 775.50 g/mol. Its IUPAC name is 5-chloro-2-[[4-(2-phenylethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole;2-[[4-(2-phenylethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole.
| Compound Name | 5-chloro-2-[[4-(2-phenylethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole;2-[[4-(2-phenylethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 67673353 |
| Molecular Formula | C34H27ClN8S6 |
| Molecular Weight | 775.50 g/mol |
| Exact Mass | 774.04 |
| IUPAC Name | 5-chloro-2-[[4-(2-phenylethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole;2-[[4-(2-phenylethyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole |
| SMILES | Clc1cnc(Sc2nnc(-c3cccs3)n2CCc2ccccc2)s1.c1ccc(CCn2c(Sc3nccs3)nnc2-c2cccs2)cc1 |
| InChI | InChI=1S/C17H13ClN4S3.C17H14N4S3/c18-14-11-19-17(24-14)25-16-21-20-15(13-7-4-10-23-13)22(16)9-8-12-5-2-1-3-6-12;1-2-5-13(6-3-1)8-10-21-15(14-7-4-11-22-14)19-20-16(21)24-17-18-9-12-23-17/h1-7,10-11H,8-9H2;1-7,9,11-12H,8,10H2 |
| InChIKey | ZOIQOBMJLKXWDX-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.50 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|