C19H17ClN4OS3 — CID 18708162
4-(4-chlorophenyl)-2-[[4-(3-methoxypropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole (PubChem CID 18708162) has the molecular formula C19H17ClN4OS3 and a molecular weight of 449.03 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[[4-(3-methoxypropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole.
| Compound Name | 4-(4-chlorophenyl)-2-[[4-(3-methoxypropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 18708162 |
| Molecular Formula | C19H17ClN4OS3 |
| Molecular Weight | 449.03 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[[4-(3-methoxypropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazole |
| SMILES | COCCCn1c(Sc2nc(-c3ccc(Cl)cc3)cs2)nnc1-c1cccs1 |
| InChI | InChI=1S/C19H17ClN4OS3/c1-25-10-3-9-24-17(16-4-2-11-26-16)22-23-18(24)28-19-21-15(12-27-19)13-5-7-14(20)8-6-13/h2,4-8,11-12H,3,9-10H2,1H3 |
| InChIKey | WHGRCRWJUCZIDK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.03 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|