C14H16N4OS3 — CID 18778659
2-[[4-(3-methoxypropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-4-methyl-1,3-thiazole (PubChem CID 18778659) has the molecular formula C14H16N4OS3 and a molecular weight of 352.51 g/mol. Its IUPAC name is 2-[[4-(3-methoxypropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[[4-(3-methoxypropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 18778659 |
| Molecular Formula | C14H16N4OS3 |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-[[4-(3-methoxypropyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-4-methyl-1,3-thiazole |
| SMILES | COCCCn1c(Sc2nc(C)cs2)nnc1-c1cccs1 |
| InChI | InChI=1S/C14H16N4OS3/c1-10-9-21-14(15-10)22-13-17-16-12(11-5-3-8-20-11)18(13)6-4-7-19-2/h3,5,8-9H,4,6-7H2,1-2H3 |
| InChIKey | RQPUBJUISREGPM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|