C22H23N5O3S4 — CID 18708083
N-[2-[[4-(5-methylsulfonylpentyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazol-5-yl]benzamide (PubChem CID 18708083) has the molecular formula C22H23N5O3S4 and a molecular weight of 533.73 g/mol. Its IUPAC name is N-[2-[[4-(5-methylsulfonylpentyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazol-5-yl]benzamide.
| Compound Name | N-[2-[[4-(5-methylsulfonylpentyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 18708083 |
| Molecular Formula | C22H23N5O3S4 |
| Molecular Weight | 533.73 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | N-[2-[[4-(5-methylsulfonylpentyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-1,3-thiazol-5-yl]benzamide |
| SMILES | CS(=O)(=O)CCCCCn1c(Sc2ncc(NC(=O)c3ccccc3)s2)nnc1-c1cccs1 |
| InChI | InChI=1S/C22H23N5O3S4/c1-34(29,30)14-7-3-6-12-27-19(17-11-8-13-31-17)25-26-21(27)33-22-23-15-18(32-22)24-20(28)16-9-4-2-5-10-16/h2,4-5,8-11,13,15H,3,6-7,12,14H2,1H3,(H,24,28) |
| InChIKey | RONIGFWPAPKOHV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|