About 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid
3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid (PubChem CID 83293518) has the molecular formula C10H9N3O2S
and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid.
Analyze 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid?
The IUPAC name of 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid (CID 83293518) is 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid.
What is the SMILES notation for 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid?
The canonical SMILES for 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid is NCc1csc(-c2cccnc2C(=O)O)n1.
What is the InChIKey of 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid?
The InChIKey is NUAMAMLEJMNMKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2S/c11-4-6-5-16-9(13-6)7-2-1-3-12-8(7)10(14)15/h1-3,5H,4,11H2,(H,14,15).
What are the key properties of 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid?
3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid has a molecular weight of 235.27 g/mol, XLogP of 1.36, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(aminomethyl)-1,3-thiazol-2-yl]pyridine-2-carboxylic acid is sourced from PubChem (CID 83293518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).