C16H17F2N3O5S — CID 25050874
1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-[4-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]urea (PubChem CID 25050874) has the molecular formula C16H17F2N3O5S and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-[4-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-[4-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 25050874 |
| Molecular Formula | C16H17F2N3O5S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-[4-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]urea |
| SMILES | COCCOCc1csc(NC(=O)NCc2ccc3c(c2)OC(F)(F)O3)n1 |
| InChI | InChI=1S/C16H17F2N3O5S/c1-23-4-5-24-8-11-9-27-15(20-11)21-14(22)19-7-10-2-3-12-13(6-10)26-16(17,18)25-12/h2-3,6,9H,4-5,7-8H2,1H3,(H2,19,20,21,22) |
| InChIKey | XTSSJWNOURPMSG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|