C16H20Cl2N4O2S — CID 87726708
1-[(3,4-dichlorophenyl)methyl]-3-[4-[2-(dimethylamino)ethoxymethyl]-1,3-thiazol-2-yl]urea (PubChem CID 87726708) has the molecular formula C16H20Cl2N4O2S and a molecular weight of 403.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[4-[2-(dimethylamino)ethoxymethyl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[4-[2-(dimethylamino)ethoxymethyl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 87726708 |
| Molecular Formula | C16H20Cl2N4O2S |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[4-[2-(dimethylamino)ethoxymethyl]-1,3-thiazol-2-yl]urea |
| SMILES | CN(C)CCOCc1csc(NC(=O)NCc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H20Cl2N4O2S/c1-22(2)5-6-24-9-12-10-25-16(20-12)21-15(23)19-8-11-3-4-13(17)14(18)7-11/h3-4,7,10H,5-6,8-9H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | RBSQSSXJCMDTJE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|