C16H17Cl2N4O3S+ — CID 87171934
1-[(3,4-dichlorophenyl)methyl]-3-[4-[(3-hydroxy-2-methyl-5H-1,2-oxazol-2-ium-2-yl)methyl]-1,3-thiazol-2-yl]urea (PubChem CID 87171934) has the molecular formula C16H17Cl2N4O3S+ and a molecular weight of 416.31 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[4-[(3-hydroxy-2-methyl-5H-1,2-oxazol-2-ium-2-yl)methyl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[4-[(3-hydroxy-2-methyl-5H-1,2-oxazol-2-ium-2-yl)methyl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 87171934 |
| Molecular Formula | C16H17Cl2N4O3S+ |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[4-[(3-hydroxy-2-methyl-5H-1,2-oxazol-2-ium-2-yl)methyl]-1,3-thiazol-2-yl]urea |
| SMILES | C[N+]1(Cc2csc(NC(=O)NCc3ccc(Cl)c(Cl)c3)n2)OCC=C1O |
| InChI | InChI=1S/C16H16Cl2N4O3S/c1-22(14(23)4-5-25-22)8-11-9-26-16(20-11)21-15(24)19-7-10-2-3-12(17)13(18)6-10/h2-4,6,9H,5,7-8H2,1H3,(H2-,19,20,21,23,24)/p+1 |
| InChIKey | MGUCMZVKNYGBBR-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|