C20H24Cl2N4O6S — CID 87756290
1-[(3,4-dichlorophenyl)methyl]-3-[4-(2-pyrrolidin-1-ylethoxymethyl)-1,3-thiazol-2-yl]urea;oxalic acid (PubChem CID 87756290) has the molecular formula C20H24Cl2N4O6S and a molecular weight of 519.41 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[4-(2-pyrrolidin-1-ylethoxymethyl)-1,3-thiazol-2-yl]urea;oxalic acid.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[4-(2-pyrrolidin-1-ylethoxymethyl)-1,3-thiazol-2-yl]urea;oxalic acid |
|---|---|
| PubChem CID | 87756290 |
| Molecular Formula | C20H24Cl2N4O6S |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[4-(2-pyrrolidin-1-ylethoxymethyl)-1,3-thiazol-2-yl]urea;oxalic acid |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)Nc1nc(COCCN2CCCC2)cs1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H22Cl2N4O2S.C2H2O4/c19-15-4-3-13(9-16(15)20)10-21-17(25)23-18-22-14(12-27-18)11-26-8-7-24-5-1-2-6-24;3-1(4)2(5)6/h3-4,9,12H,1-2,5-8,10-11H2,(H2,21,22,23,25);(H,3,4)(H,5,6) |
| InChIKey | JFSPMIMPYAKKGE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|