C20H20Cl2N4O2 — CID 5164506
1-[(3,4-dichlorophenyl)methyl]-3-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]urea (PubChem CID 5164506) has the molecular formula C20H20Cl2N4O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 5164506 |
| Molecular Formula | C20H20Cl2N4O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]urea |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)Nc1cnn(CCOCc2ccccc2)c1 |
| InChI | InChI=1S/C20H20Cl2N4O2/c21-18-7-6-16(10-19(18)22)11-23-20(27)25-17-12-24-26(13-17)8-9-28-14-15-4-2-1-3-5-15/h1-7,10,12-13H,8-9,11,14H2,(H2,23,25,27) |
| InChIKey | PXVJAXXGRVOMHI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|