C18H18ClN3O4S2 — CID 3764669
3-chloro-4-methylsulfonyl-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]thiophene-2-carboxamide (PubChem CID 3764669) has the molecular formula C18H18ClN3O4S2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 3-chloro-4-methylsulfonyl-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]thiophene-2-carboxamide.
| Compound Name | 3-chloro-4-methylsulfonyl-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3764669 |
| Molecular Formula | C18H18ClN3O4S2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 3-chloro-4-methylsulfonyl-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)c1csc(C(=O)Nc2cnn(CCOCc3ccccc3)c2)c1Cl |
| InChI | InChI=1S/C18H18ClN3O4S2/c1-28(24,25)15-12-27-17(16(15)19)18(23)21-14-9-20-22(10-14)7-8-26-11-13-5-3-2-4-6-13/h2-6,9-10,12H,7-8,11H2,1H3,(H,21,23) |
| InChIKey | ARDKVZMMKOHYHU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|