C25H29N3O5 — CID 3404846
2-methyl-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 3404846) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-methyl-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | 2-methyl-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3404846 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-methyl-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(OC)c(OC)cc1C=C(C)C(=O)Nc1cnn(CCOCc2ccccc2)c1 |
| InChI | InChI=1S/C25H29N3O5/c1-18(12-20-13-23(31-3)24(32-4)14-22(20)30-2)25(29)27-21-15-26-28(16-21)10-11-33-17-19-8-6-5-7-9-19/h5-9,12-16H,10-11,17H2,1-4H3,(H,27,29) |
| InChIKey | BJXFGCYTADEEHY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|