C24H24N4O3 — CID 3788448
2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]acetamide (PubChem CID 3788448) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]acetamide.
| Compound Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 3788448 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]acetamide |
| SMILES | Cc1oc(-c2ccccc2)nc1CC(=O)Nc1cnn(CCOCc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N4O3/c1-18-22(27-24(31-18)20-10-6-3-7-11-20)14-23(29)26-21-15-25-28(16-21)12-13-30-17-19-8-4-2-5-9-19/h2-11,15-16H,12-14,17H2,1H3,(H,26,29) |
| InChIKey | DYSDLUXDLVXAPQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|