C21H19BrFN3O2 — CID 3272990
3-(3-bromo-4-fluorophenyl)-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 3272990) has the molecular formula C21H19BrFN3O2 and a molecular weight of 444.30 g/mol. Its IUPAC name is 3-(3-bromo-4-fluorophenyl)-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | 3-(3-bromo-4-fluorophenyl)-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3272990 |
| Molecular Formula | C21H19BrFN3O2 |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 3-(3-bromo-4-fluorophenyl)-N-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)c(Br)c1)Nc1cnn(CCOCc2ccccc2)c1 |
| InChI | InChI=1S/C21H19BrFN3O2/c22-19-12-16(6-8-20(19)23)7-9-21(27)25-18-13-24-26(14-18)10-11-28-15-17-4-2-1-3-5-17/h1-9,12-14H,10-11,15H2,(H,25,27) |
| InChIKey | WDVZSJGMCPHDMP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|