C16H23N5O4S — CID 55794321
1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]urea (PubChem CID 55794321) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55794321 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]urea |
| SMILES | CNS(=O)(=O)Cc1ccc(CNC(=O)Nc2cnn(CCOC)c2)cc1 |
| InChI | InChI=1S/C16H23N5O4S/c1-17-26(23,24)12-14-5-3-13(4-6-14)9-18-16(22)20-15-10-19-21(11-15)7-8-25-2/h3-6,10-11,17H,7-9,12H2,1-2H3,(H2,18,20,22) |
| InChIKey | NEJZBTVYVHYOAU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |