C17H21N3O3 — CID 126833913
3-hydroxy-N-[1-(2-methoxyethyl)pyrazol-4-yl]-1-phenylcyclobutane-1-carboxamide (PubChem CID 126833913) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-hydroxy-N-[1-(2-methoxyethyl)pyrazol-4-yl]-1-phenylcyclobutane-1-carboxamide.
| Compound Name | 3-hydroxy-N-[1-(2-methoxyethyl)pyrazol-4-yl]-1-phenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 126833913 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-hydroxy-N-[1-(2-methoxyethyl)pyrazol-4-yl]-1-phenylcyclobutane-1-carboxamide |
| SMILES | COCCn1cc(NC(=O)C2(c3ccccc3)CC(O)C2)cn1 |
| InChI | InChI=1S/C17H21N3O3/c1-23-8-7-20-12-14(11-18-20)19-16(22)17(9-15(21)10-17)13-5-3-2-4-6-13/h2-6,11-12,15,21H,7-10H2,1H3,(H,19,22) |
| InChIKey | HAJBKBGFLFJODR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |