C15H29N5O2 — CID 56814238
1-[2-(dimethylamino)-4-methylpentyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea (PubChem CID 56814238) has the molecular formula C15H29N5O2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-4-methylpentyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[2-(dimethylamino)-4-methylpentyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 56814238 |
| Molecular Formula | C15H29N5O2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | 1-[2-(dimethylamino)-4-methylpentyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea |
| SMILES | COCCn1cc(NC(=O)NCC(CC(C)C)N(C)C)cn1 |
| InChI | InChI=1S/C15H29N5O2/c1-12(2)8-14(19(3)4)10-16-15(21)18-13-9-17-20(11-13)6-7-22-5/h9,11-12,14H,6-8,10H2,1-5H3,(H2,16,18,21) |
| InChIKey | QKZCHQOBOPYNGF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |