C14H25N5O3 — CID 94095897
1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[(2R)-2-morpholin-4-ylpropyl]urea (PubChem CID 94095897) has the molecular formula C14H25N5O3 and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[(2R)-2-morpholin-4-ylpropyl]urea.
| Compound Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[(2R)-2-morpholin-4-ylpropyl]urea |
|---|---|
| PubChem CID | 94095897 |
| Molecular Formula | C14H25N5O3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[(2R)-2-morpholin-4-ylpropyl]urea |
| SMILES | COCCn1cc(NC(=O)NC[C@@H](C)N2CCOCC2)cn1 |
| InChI | InChI=1S/C14H25N5O3/c1-12(18-3-7-22-8-4-18)9-15-14(20)17-13-10-16-19(11-13)5-6-21-2/h10-12H,3-9H2,1-2H3,(H2,15,17,20)/t12-/m1/s1 |
| InChIKey | AFSPMEYCKLZXMB-GFCCVEGCSA-N |
| XLogP | 0.37 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |