About 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea
1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea (PubChem CID 95784443) has the molecular formula C18H32N4O4
and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea.
Molecular Properties
| Compound Name | 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea |
| PubChem CID | 95784443 |
| Molecular Formula | C18H32N4O4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea |
| SMILES | CCC[C@@](C)(CCCNC(=O)Nc1cnn(CCOC)c1)C1OCCO1 |
| InChI | InChI=1S/C18H32N4O4/c1-4-6-18(2,16-25-11-12-26-16)7-5-8-19-17(23)21-15-13-20-22(14-15)9-10-24-3/h13-14,16H,4-12H2,1-3H3,(H2,19,21,23)/t18-/m0/s1 |
| InChIKey | ZVZCXUTUWFOPEH-SFHVURJKSA-N |
| XLogP | 2.61 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea?
The IUPAC name of 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea (CID 95784443) is 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea.
What is the SMILES notation for 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea?
The canonical SMILES for 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea is CCC[C@@](C)(CCCNC(=O)Nc1cnn(CCOC)c1)C1OCCO1.
What is the InChIKey of 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea?
The InChIKey is ZVZCXUTUWFOPEH-SFHVURJKSA-N. The full InChI is InChI=1S/C18H32N4O4/c1-4-6-18(2,16-25-11-12-26-16)7-5-8-19-17(23)21-15-13-20-22(14-15)9-10-24-3/h13-14,16H,4-12H2,1-3H3,(H2,19,21,23)/t18-/m0/s1.
What are the key properties of 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea?
1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea has a molecular weight of 368.48 g/mol, XLogP of 2.61, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylheptyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea is sourced from PubChem (CID 95784443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).