C13H22N4O3 — CID 94031414
1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea (PubChem CID 94031414) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 94031414 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea |
| SMILES | COCCn1cc(NC(=O)N[C@H](C)[C@H]2CCCO2)cn1 |
| InChI | InChI=1S/C13H22N4O3/c1-10(12-4-3-6-20-12)15-13(18)16-11-8-14-17(9-11)5-7-19-2/h8-10,12H,3-7H2,1-2H3,(H2,15,16,18)/t10-,12-/m1/s1 |
| InChIKey | ZWHYMHHAHFFQHP-ZYHUDNBSSA-N |
| XLogP | 1.22 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |