C15H23N3O4 — CID 95568574
1-[2-(2-methoxyethoxy)-3-pyridinyl]-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea (PubChem CID 95568574) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)-3-pyridinyl]-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-[2-(2-methoxyethoxy)-3-pyridinyl]-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 95568574 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)-3-pyridinyl]-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea |
| SMILES | COCCOc1ncccc1NC(=O)N[C@H](C)[C@H]1CCCO1 |
| InChI | InChI=1S/C15H23N3O4/c1-11(13-6-4-8-21-13)17-15(19)18-12-5-3-7-16-14(12)22-10-9-20-2/h3,5,7,11,13H,4,6,8-10H2,1-2H3,(H2,17,18,19)/t11-,13-/m1/s1 |
| InChIKey | XJZLRVLCUFWMPM-DGCLKSJQSA-N |
| XLogP | 1.80 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|