C12H19N5O3 — CID 95132232
2-[4-[[(1S)-1-[(2S)-oxolan-2-yl]ethyl]carbamoylamino]pyrazol-1-yl]acetamide (PubChem CID 95132232) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[4-[[(1S)-1-[(2S)-oxolan-2-yl]ethyl]carbamoylamino]pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-[[(1S)-1-[(2S)-oxolan-2-yl]ethyl]carbamoylamino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 95132232 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-[4-[[(1S)-1-[(2S)-oxolan-2-yl]ethyl]carbamoylamino]pyrazol-1-yl]acetamide |
| SMILES | C[C@H](NC(=O)Nc1cnn(CC(N)=O)c1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C12H19N5O3/c1-8(10-3-2-4-20-10)15-12(19)16-9-5-14-17(6-9)7-11(13)18/h5-6,8,10H,2-4,7H2,1H3,(H2,13,18)(H2,15,16,19)/t8-,10-/m0/s1 |
| InChIKey | UOXKBRHYOQMYQI-WPRPVWTQSA-N |
| XLogP | 0.06 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |