C16H21N5O3 — CID 95132885
2-[4-[[(2R)-4-(4-hydroxyphenyl)butan-2-yl]carbamoylamino]pyrazol-1-yl]acetamide (PubChem CID 95132885) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[4-[[(2R)-4-(4-hydroxyphenyl)butan-2-yl]carbamoylamino]pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-[[(2R)-4-(4-hydroxyphenyl)butan-2-yl]carbamoylamino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 95132885 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[4-[[(2R)-4-(4-hydroxyphenyl)butan-2-yl]carbamoylamino]pyrazol-1-yl]acetamide |
| SMILES | C[C@H](CCc1ccc(O)cc1)NC(=O)Nc1cnn(CC(N)=O)c1 |
| InChI | InChI=1S/C16H21N5O3/c1-11(2-3-12-4-6-14(22)7-5-12)19-16(24)20-13-8-18-21(9-13)10-15(17)23/h4-9,11,22H,2-3,10H2,1H3,(H2,17,23)(H2,19,20,24)/t11-/m1/s1 |
| InChIKey | LCMWOJSFKUQEPZ-LLVKDONJSA-N |
| XLogP | 1.22 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |