C13H18N4O2 — CID 43695320
2-[4-[4-(furan-2-yl)butan-2-ylamino]pyrazol-1-yl]acetamide (PubChem CID 43695320) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[4-[4-(furan-2-yl)butan-2-ylamino]pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-[4-(furan-2-yl)butan-2-ylamino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 43695320 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[4-[4-(furan-2-yl)butan-2-ylamino]pyrazol-1-yl]acetamide |
| SMILES | CC(CCc1ccco1)Nc1cnn(CC(N)=O)c1 |
| InChI | InChI=1S/C13H18N4O2/c1-10(4-5-12-3-2-6-19-12)16-11-7-15-17(8-11)9-13(14)18/h2-3,6-8,10,16H,4-5,9H2,1H3,(H2,14,18) |
| InChIKey | FQTRHQXGGWUCEI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |