C10H16N2O3 — CID 112673041
2-[4-(furan-2-yl)butan-2-ylamino]oxyacetamide (PubChem CID 112673041) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)butan-2-ylamino]oxyacetamide.
| Compound Name | 2-[4-(furan-2-yl)butan-2-ylamino]oxyacetamide |
|---|---|
| PubChem CID | 112673041 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[4-(furan-2-yl)butan-2-ylamino]oxyacetamide |
| SMILES | CC(CCc1ccco1)NOCC(N)=O |
| InChI | InChI=1S/C10H16N2O3/c1-8(12-15-7-10(11)13)4-5-9-3-2-6-14-9/h2-3,6,8,12H,4-5,7H2,1H3,(H2,11,13) |
| InChIKey | QMSYFLNMKMQVDO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|