C15H19FN4O3 — CID 94031186
1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea (PubChem CID 94031186) has the molecular formula C15H19FN4O3 and a molecular weight of 322.34 g/mol. Its IUPAC name is 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 94031186 |
| Molecular Formula | C15H19FN4O3 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[1-(2-methoxyethyl)pyrazol-4-yl]urea |
| SMILES | COCCn1cc(NC(=O)NC[C@@H](O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C15H19FN4O3/c1-23-7-6-20-10-13(8-18-20)19-15(22)17-9-14(21)11-2-4-12(16)5-3-11/h2-5,8,10,14,21H,6-7,9H2,1H3,(H2,17,19,22)/t14-/m1/s1 |
| InChIKey | YOTOIPVLZDCAJR-CQSZACIVSA-N |
| XLogP | 1.52 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |