C22H26Cl2N4O2S — CID 87718501
1-[(3,4-dichlorophenyl)methyl]-3-[4-(2,3,4,6,7,8-hexahydro-1H-quinolizin-1-ylmethoxymethyl)-1,3-thiazol-2-yl]urea (PubChem CID 87718501) has the molecular formula C22H26Cl2N4O2S and a molecular weight of 481.45 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[4-(2,3,4,6,7,8-hexahydro-1H-quinolizin-1-ylmethoxymethyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[4-(2,3,4,6,7,8-hexahydro-1H-quinolizin-1-ylmethoxymethyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 87718501 |
| Molecular Formula | C22H26Cl2N4O2S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[4-(2,3,4,6,7,8-hexahydro-1H-quinolizin-1-ylmethoxymethyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)Nc1nc(COCC2CCCN3CCCC=C23)cs1 |
| InChI | InChI=1S/C22H26Cl2N4O2S/c23-18-7-6-15(10-19(18)24)11-25-21(29)27-22-26-17(14-31-22)13-30-12-16-4-3-9-28-8-2-1-5-20(16)28/h5-7,10,14,16H,1-4,8-9,11-13H2,(H2,25,26,27,29) |
| InChIKey | OTEQADXRYUBFGO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |