C15H17ClN2O2S — CID 43248142
N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]-2-propoxyacetamide (PubChem CID 43248142) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]-2-propoxyacetamide.
| Compound Name | N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]-2-propoxyacetamide |
|---|---|
| PubChem CID | 43248142 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]-2-propoxyacetamide |
| SMILES | CCCOCC(=O)Nc1ccc(-c2nc(CCl)cs2)cc1 |
| InChI | InChI=1S/C15H17ClN2O2S/c1-2-7-20-9-14(19)17-12-5-3-11(4-6-12)15-18-13(8-16)10-21-15/h3-6,10H,2,7-9H2,1H3,(H,17,19) |
| InChIKey | ZUFMJSLFDGOHGC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|