C12H9IN2O3S — CID 43089417
2-[2-[(4-iodobenzoyl)amino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 43089417) has the molecular formula C12H9IN2O3S and a molecular weight of 388.19 g/mol. Its IUPAC name is 2-[2-[(4-iodobenzoyl)amino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(4-iodobenzoyl)amino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 43089417 |
| Molecular Formula | C12H9IN2O3S |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | 2-[2-[(4-iodobenzoyl)amino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NC(=O)c2ccc(I)cc2)n1 |
| InChI | InChI=1S/C12H9IN2O3S/c13-8-3-1-7(2-4-8)11(18)15-12-14-9(6-19-12)5-10(16)17/h1-4,6H,5H2,(H,16,17)(H,14,15,18) |
| InChIKey | DJNUXBLLQQIAAE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|