C13H10N4O3S — CID 43354595
2-[2-(1H-indazole-6-carbonylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 43354595) has the molecular formula C13H10N4O3S and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-[2-(1H-indazole-6-carbonylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(1H-indazole-6-carbonylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 43354595 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-[2-(1H-indazole-6-carbonylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NC(=O)c2ccc3cn[nH]c3c2)n1 |
| InChI | InChI=1S/C13H10N4O3S/c18-11(19)4-9-6-21-13(15-9)16-12(20)7-1-2-8-5-14-17-10(8)3-7/h1-3,5-6H,4H2,(H,14,17)(H,18,19)(H,15,16,20) |
| InChIKey | HFCRATYXLFXVCI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |