2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid

C8H6N4O3S2 — CID 62032288

IUPAC2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(NC(=O)c2csnn2)n1
InChIInChI=1S/C8H6N4O3S2/c13-6(14)1-4-2-16-8(9-4)10-7(15)5-3-17-12-11-5/h2-3H,1H2,(H,13,14)(H,9,10,15)
InChIKeyRJNGSALEPQZVTP-UHFFFAOYSA-N
MW270.30 g/mol
LogP0.87
Rot. Bonds4

About 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid

2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 62032288) has the molecular formula C8H6N4O3S2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid
PubChem CID62032288
Molecular FormulaC8H6N4O3S2
Molecular Weight270.30 g/mol
Exact Mass269.99
IUPAC Name2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(NC(=O)c2csnn2)n1
InChIInChI=1S/C8H6N4O3S2/c13-6(14)1-4-2-16-8(9-4)10-7(15)5-3-17-12-11-5/h2-3H,1H2,(H,13,14)(H,9,10,15)
InChIKeyRJNGSALEPQZVTP-UHFFFAOYSA-N
XLogP0.87
TPSA105.07 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.30
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Analyze 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid (CID 62032288) is 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(NC(=O)c2csnn2)n1.
What is the InChIKey of 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is RJNGSALEPQZVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O3S2/c13-6(14)1-4-2-16-8(9-4)10-7(15)5-3-17-12-11-5/h2-3H,1H2,(H,13,14)(H,9,10,15).
What are the key properties of 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid?
2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 270.30 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(thiadiazole-4-carbonylamino)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 62032288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).