C10H8N2O4S — CID 16774692
2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 16774692) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 16774692 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NC(=O)c2ccoc2)n1 |
| InChI | InChI=1S/C10H8N2O4S/c13-8(14)3-7-5-17-10(11-7)12-9(15)6-1-2-16-4-6/h1-2,4-5H,3H2,(H,13,14)(H,11,12,15) |
| InChIKey | HFUPHCFBUHRODU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |