2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid

C10H8N2O4S — CID 16774692

IUPAC2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(NC(=O)c2ccoc2)n1
InChIInChI=1S/C10H8N2O4S/c13-8(14)3-7-5-17-10(11-7)12-9(15)6-1-2-16-4-6/h1-2,4-5H,3H2,(H,13,14)(H,11,12,15)
InChIKeyHFUPHCFBUHRODU-UHFFFAOYSA-N
MW252.25 g/mol
LogP1.62
Rot. Bonds4

About 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid

2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 16774692) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid
PubChem CID16774692
Molecular FormulaC10H8N2O4S
Molecular Weight252.25 g/mol
Exact Mass252.02
IUPAC Name2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(NC(=O)c2ccoc2)n1
InChIInChI=1S/C10H8N2O4S/c13-8(14)3-7-5-17-10(11-7)12-9(15)6-1-2-16-4-6/h1-2,4-5H,3H2,(H,13,14)(H,11,12,15)
InChIKeyHFUPHCFBUHRODU-UHFFFAOYSA-N
XLogP1.62
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.25
LogP ≤ 51.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid (CID 16774692) is 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(NC(=O)c2ccoc2)n1.
What is the InChIKey of 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is HFUPHCFBUHRODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4S/c13-8(14)3-7-5-17-10(11-7)12-9(15)6-1-2-16-4-6/h1-2,4-5H,3H2,(H,13,14)(H,11,12,15).
What are the key properties of 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid?
2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 252.25 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(furan-3-carbonylamino)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 16774692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).