C13H17ClINO2 — CID 103222118
3-chloro-4-iodo-N-(1-methoxypentan-2-yl)benzamide (PubChem CID 103222118) has the molecular formula C13H17ClINO2 and a molecular weight of 381.64 g/mol. Its IUPAC name is 3-chloro-4-iodo-N-(1-methoxypentan-2-yl)benzamide.
| Compound Name | 3-chloro-4-iodo-N-(1-methoxypentan-2-yl)benzamide |
|---|---|
| PubChem CID | 103222118 |
| Molecular Formula | C13H17ClINO2 |
| Molecular Weight | 381.64 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 3-chloro-4-iodo-N-(1-methoxypentan-2-yl)benzamide |
| SMILES | CCCC(COC)NC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClINO2/c1-3-4-10(8-18-2)16-13(17)9-5-6-12(15)11(14)7-9/h5-7,10H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | XJGDTWNOMUFJQG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|