C12H15ClINOS — CID 103222227
3-chloro-4-iodo-N-(1-methylsulfanylbutan-2-yl)benzamide (PubChem CID 103222227) has the molecular formula C12H15ClINOS and a molecular weight of 383.68 g/mol. Its IUPAC name is 3-chloro-4-iodo-N-(1-methylsulfanylbutan-2-yl)benzamide.
| Compound Name | 3-chloro-4-iodo-N-(1-methylsulfanylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 103222227 |
| Molecular Formula | C12H15ClINOS |
| Molecular Weight | 383.68 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 3-chloro-4-iodo-N-(1-methylsulfanylbutan-2-yl)benzamide |
| SMILES | CCC(CSC)NC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClINOS/c1-3-9(7-17-2)15-12(16)8-4-5-11(14)10(13)6-8/h4-6,9H,3,7H2,1-2H3,(H,15,16) |
| InChIKey | VANBEXLHXYDQAE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|