C13H14F3NO5 — CID 58342810
N-(1,5-dihydroxy-2-oxopentan-3-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 58342810) has the molecular formula C13H14F3NO5 and a molecular weight of 321.25 g/mol. Its IUPAC name is N-(1,5-dihydroxy-2-oxopentan-3-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(1,5-dihydroxy-2-oxopentan-3-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 58342810 |
| Molecular Formula | C13H14F3NO5 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-(1,5-dihydroxy-2-oxopentan-3-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NC(CCO)C(=O)CO)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO5/c14-13(15,16)22-9-3-1-8(2-4-9)12(21)17-10(5-6-18)11(20)7-19/h1-4,10,18-19H,5-7H2,(H,17,21) |
| InChIKey | IEJKXCVJGMJBHE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |