C10H10N4O2 — CID 79193732
4-amino-N-[2-(cyanoamino)-2-oxoethyl]benzamide (PubChem CID 79193732) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-amino-N-[2-(cyanoamino)-2-oxoethyl]benzamide.
| Compound Name | 4-amino-N-[2-(cyanoamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 79193732 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-amino-N-[2-(cyanoamino)-2-oxoethyl]benzamide |
| SMILES | N#CNC(=O)CNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H10N4O2/c11-6-14-9(15)5-13-10(16)7-1-3-8(12)4-2-7/h1-4H,5,12H2,(H,13,16)(H,14,15) |
| InChIKey | VDZBAFQOOPJDSC-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|