About 4-amino-N-cyanobenzamide
4-amino-N-cyanobenzamide (PubChem CID 12713849) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-amino-N-cyanobenzamide.
Molecular Properties
| Compound Name | 4-amino-N-cyanobenzamide |
| PubChem CID | 12713849 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 4-amino-N-cyanobenzamide |
| SMILES | N#CNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C8H7N3O/c9-5-11-8(12)6-1-3-7(10)4-2-6/h1-4H,10H2,(H,11,12) |
| InChIKey | TTXMBQPCLWNGDO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-cyanobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-cyanobenzamide?
The IUPAC name of 4-amino-N-cyanobenzamide (CID 12713849) is 4-amino-N-cyanobenzamide.
What is the SMILES notation for 4-amino-N-cyanobenzamide?
The canonical SMILES for 4-amino-N-cyanobenzamide is N#CNC(=O)c1ccc(N)cc1.
What is the InChIKey of 4-amino-N-cyanobenzamide?
The InChIKey is TTXMBQPCLWNGDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-5-11-8(12)6-1-3-7(10)4-2-6/h1-4H,10H2,(H,11,12).
What are the key properties of 4-amino-N-cyanobenzamide?
4-amino-N-cyanobenzamide has a molecular weight of 161.16 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-cyanobenzamide is sourced from PubChem (CID 12713849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).