C13H21N3O2S — CID 47263950
N',N'-bis(2-methylpropyl)-N-(1,3-thiazol-2-yl)oxamide (PubChem CID 47263950) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N',N'-bis(2-methylpropyl)-N-(1,3-thiazol-2-yl)oxamide.
| Compound Name | N',N'-bis(2-methylpropyl)-N-(1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 47263950 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N',N'-bis(2-methylpropyl)-N-(1,3-thiazol-2-yl)oxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H21N3O2S/c1-9(2)7-16(8-10(3)4)12(18)11(17)15-13-14-5-6-19-13/h5-6,9-10H,7-8H2,1-4H3,(H,14,15,17) |
| InChIKey | YUPPXCDMGNOVPG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|