C16H12Cl2F3N3O3 — CID 142647933
3-chloro-N-(2-chloro-3-pyridinyl)-4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino]benzamide (PubChem CID 142647933) has the molecular formula C16H12Cl2F3N3O3 and a molecular weight of 422.19 g/mol. Its IUPAC name is 3-chloro-N-(2-chloro-3-pyridinyl)-4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino]benzamide.
| Compound Name | 3-chloro-N-(2-chloro-3-pyridinyl)-4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino]benzamide |
|---|---|
| PubChem CID | 142647933 |
| Molecular Formula | C16H12Cl2F3N3O3 |
| Molecular Weight | 422.19 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 3-chloro-N-(2-chloro-3-pyridinyl)-4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino]benzamide |
| SMILES | C[C@@](O)(C(=O)Nc1ccc(C(=O)Nc2cccnc2Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C16H12Cl2F3N3O3/c1-15(27,16(19,20)21)14(26)24-10-5-4-8(7-9(10)17)13(25)23-11-3-2-6-22-12(11)18/h2-7,27H,1H3,(H,23,25)(H,24,26)/t15-/m1/s1 |
| InChIKey | YTDRTVRYKTXKJX-OAHLLOKOSA-N |
| XLogP | 3.89 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|