C17H11ClF6N2O2S — CID 16514536
2-[[2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 16514536) has the molecular formula C17H11ClF6N2O2S and a molecular weight of 456.80 g/mol. Its IUPAC name is 2-[[2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 16514536 |
| Molecular Formula | C17H11ClF6N2O2S |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 2-[[2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CSc1ccc(Cl)c(C(F)(F)F)c1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H11ClF6N2O2S/c18-10-2-1-8(5-9(10)17(22,23)24)29-7-14(28)25-6-13(27)26-12-4-3-11(19)15(20)16(12)21/h1-5H,6-7H2,(H,25,28)(H,26,27) |
| InChIKey | XBOWNXMNJUVZIH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|