C17H13ClF3NO2S — CID 7363976
N-(2-acetylphenyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 7363976) has the molecular formula C17H13ClF3NO2S and a molecular weight of 387.81 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-(2-acetylphenyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 7363976 |
| Molecular Formula | C17H13ClF3NO2S |
| Molecular Weight | 387.81 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-(2-acetylphenyl)-2-[4-chloro-3-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | CC(=O)c1ccccc1NC(=O)CSc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13ClF3NO2S/c1-10(23)12-4-2-3-5-15(12)22-16(24)9-25-11-6-7-14(18)13(8-11)17(19,20)21/h2-8H,9H2,1H3,(H,22,24) |
| InChIKey | OADJARPBYDRIES-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.81 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |