C13H19ClN3O2+ — CID 8520047
N-(2-chloro-3-pyridinyl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide (PubChem CID 8520047) has the molecular formula C13H19ClN3O2+ and a molecular weight of 284.77 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide |
|---|---|
| PubChem CID | 8520047 |
| Molecular Formula | C13H19ClN3O2+ |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide |
| SMILES | C[C@@H]1C[NH+](CC(=O)Nc2cccnc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-9-6-17(7-10(2)19-9)8-12(18)16-11-4-3-5-15-13(11)14/h3-5,9-10H,6-8H2,1-2H3,(H,16,18)/p+1/t9-,10+ |
| InChIKey | PNZOLZHZYQWAIU-AOOOYVTPSA-O |
| XLogP | 0.37 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|