C16H26N3O2+ — CID 8529542
N-[(2R)-butan-2-yl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8529542) has the molecular formula C16H26N3O2+ and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8529542 |
| Molecular Formula | C16H26N3O2+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CC[C@@H](C)NC(=O)C[NH+]1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C16H25N3O2/c1-3-13(2)17-16(21)12-18-8-10-19(11-9-18)14-6-4-5-7-15(14)20/h4-7,13,20H,3,8-12H2,1-2H3,(H,17,21)/p+1/t13-/m1/s1 |
| InChIKey | DBIRTQMRRQDAGY-CYBMUJFWSA-O |
| XLogP | 0.01 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |