C20H25BrN3O2+ — CID 8528960
N-[(1S)-1-(2-bromophenyl)ethyl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8528960) has the molecular formula C20H25BrN3O2+ and a molecular weight of 419.34 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromophenyl)ethyl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[(1S)-1-(2-bromophenyl)ethyl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8528960 |
| Molecular Formula | C20H25BrN3O2+ |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[(1S)-1-(2-bromophenyl)ethyl]-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | C[C@H](NC(=O)C[NH+]1CCN(c2ccccc2O)CC1)c1ccccc1Br |
| InChI | InChI=1S/C20H24BrN3O2/c1-15(16-6-2-3-7-17(16)21)22-20(26)14-23-10-12-24(13-11-23)18-8-4-5-9-19(18)25/h2-9,15,25H,10-14H2,1H3,(H,22,26)/p+1/t15-/m0/s1 |
| InChIKey | UMBJOXWJMASBAB-HNNXBMFYSA-O |
| XLogP | 1.74 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |