C24H28N3O2+ — CID 8528949
2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 8528949) has the molecular formula C24H28N3O2+ and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 8528949 |
| Molecular Formula | C24H28N3O2+ |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | C[C@H](NC(=O)C[NH+]1CCN(c2ccccc2O)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H27N3O2/c1-18(20-11-10-19-6-2-3-7-21(19)16-20)25-24(29)17-26-12-14-27(15-13-26)22-8-4-5-9-23(22)28/h2-11,16,18,28H,12-15,17H2,1H3,(H,25,29)/p+1/t18-/m0/s1 |
| InChIKey | RZFDWKXHTDGQLF-SFHVURJKSA-O |
| XLogP | 2.13 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |