C19H24FN2OS+ — CID 6986666
(2R)-1-(4-fluorophenyl)sulfanyl-3-(4-phenylpiperazin-1-ium-1-yl)propan-2-ol (PubChem CID 6986666) has the molecular formula C19H24FN2OS+ and a molecular weight of 347.48 g/mol. Its IUPAC name is (2R)-1-(4-fluorophenyl)sulfanyl-3-(4-phenylpiperazin-1-ium-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(4-fluorophenyl)sulfanyl-3-(4-phenylpiperazin-1-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 6986666 |
| Molecular Formula | C19H24FN2OS+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (2R)-1-(4-fluorophenyl)sulfanyl-3-(4-phenylpiperazin-1-ium-1-yl)propan-2-ol |
| SMILES | O[C@@H](CSc1ccc(F)cc1)C[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23FN2OS/c20-16-6-8-19(9-7-16)24-15-18(23)14-21-10-12-22(13-11-21)17-4-2-1-3-5-17/h1-9,18,23H,10-15H2/p+1/t18-/m1/s1 |
| InChIKey | UHHJMQRPTZJRPZ-GOSISDBHSA-O |
| XLogP | 1.68 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |