C19H22Cl2N2OS — CID 1478990
(2R)-1-(3,4-dichlorophenyl)sulfanyl-3-(4-phenylpiperazin-1-yl)propan-2-ol (PubChem CID 1478990) has the molecular formula C19H22Cl2N2OS and a molecular weight of 397.37 g/mol. Its IUPAC name is (2R)-1-(3,4-dichlorophenyl)sulfanyl-3-(4-phenylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(3,4-dichlorophenyl)sulfanyl-3-(4-phenylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 1478990 |
| Molecular Formula | C19H22Cl2N2OS |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (2R)-1-(3,4-dichlorophenyl)sulfanyl-3-(4-phenylpiperazin-1-yl)propan-2-ol |
| SMILES | O[C@@H](CSc1ccc(Cl)c(Cl)c1)CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22Cl2N2OS/c20-18-7-6-17(12-19(18)21)25-14-16(24)13-22-8-10-23(11-9-22)15-4-2-1-3-5-15/h1-7,12,16,24H,8-11,13-14H2/t16-/m1/s1 |
| InChIKey | BHTNAJHZNPSVAI-MRXNPFEDSA-N |
| XLogP | 4.27 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |