C19H22ClFN2OS — CID 1476137
(2R)-1-(3-chlorophenyl)sulfanyl-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 1476137) has the molecular formula C19H22ClFN2OS and a molecular weight of 380.92 g/mol. Its IUPAC name is (2R)-1-(3-chlorophenyl)sulfanyl-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(3-chlorophenyl)sulfanyl-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 1476137 |
| Molecular Formula | C19H22ClFN2OS |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (2R)-1-(3-chlorophenyl)sulfanyl-3-[4-(2-fluorophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | O[C@@H](CSc1cccc(Cl)c1)CN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H22ClFN2OS/c20-15-4-3-5-17(12-15)25-14-16(24)13-22-8-10-23(11-9-22)19-7-2-1-6-18(19)21/h1-7,12,16,24H,8-11,13-14H2/t16-/m1/s1 |
| InChIKey | FNKOKRFQJNUDPY-MRXNPFEDSA-N |
| XLogP | 3.75 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |