C19H31NO4S — CID 169235724
2,2,4,4,5-pentamethylhexyl N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 169235724) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is 2,2,4,4,5-pentamethylhexyl N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | 2,2,4,4,5-pentamethylhexyl N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 169235724 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2,2,4,4,5-pentamethylhexyl N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)OCC(C)(C)CC(C)(C)C(C)C)cc1 |
| InChI | InChI=1S/C19H31NO4S/c1-14(2)19(6,7)12-18(4,5)13-24-17(21)20-25(22,23)16-10-8-15(3)9-11-16/h8-11,14H,12-13H2,1-7H3,(H,20,21) |
| InChIKey | JOHNHDSUCLCGLR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |